C6H5ClF2N2O3S — CID 118998534
2-chloro-5-(difluoromethyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 118998534) has the molecular formula C6H5ClF2N2O3S and a molecular weight of 258.63 g/mol. Its IUPAC name is 2-chloro-5-(difluoromethyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 2-chloro-5-(difluoromethyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118998534 |
| Molecular Formula | C6H5ClF2N2O3S |
| Molecular Weight | 258.63 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 2-chloro-5-(difluoromethyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(F)F)c(=O)[nH]c1Cl |
| InChI | InChI=1S/C6H5ClF2N2O3S/c7-4-3(15(10,13)14)1-2(5(8)9)6(12)11-4/h1,5H,(H,11,12)(H2,10,13,14) |
| InChIKey | BCNDQMYQVUEQBH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.63 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|