About 3-bromopiperidin-4-one;hydrochloride
3-bromopiperidin-4-one;hydrochloride (PubChem CID 118999019) has the molecular formula C5H9BrClNO
and a molecular weight of 214.49 g/mol. Its IUPAC name is 3-bromopiperidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 3-bromopiperidin-4-one;hydrochloride |
| PubChem CID | 118999019 |
| Molecular Formula | C5H9BrClNO |
| Molecular Weight | 214.49 g/mol |
| Exact Mass | 212.96 |
| IUPAC Name | 3-bromopiperidin-4-one;hydrochloride |
| SMILES | Cl.O=C1CCNCC1Br |
| InChI | InChI=1S/C5H8BrNO.ClH/c6-4-3-7-2-1-5(4)8;/h4,7H,1-3H2;1H |
| InChIKey | FEXBILDGVKDCMK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopiperidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopiperidin-4-one;hydrochloride?
The IUPAC name of 3-bromopiperidin-4-one;hydrochloride (CID 118999019) is 3-bromopiperidin-4-one;hydrochloride.
What is the SMILES notation for 3-bromopiperidin-4-one;hydrochloride?
The canonical SMILES for 3-bromopiperidin-4-one;hydrochloride is Cl.O=C1CCNCC1Br.
What is the InChIKey of 3-bromopiperidin-4-one;hydrochloride?
The InChIKey is FEXBILDGVKDCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrNO.ClH/c6-4-3-7-2-1-5(4)8;/h4,7H,1-3H2;1H.
What are the key properties of 3-bromopiperidin-4-one;hydrochloride?
3-bromopiperidin-4-one;hydrochloride has a molecular weight of 214.49 g/mol, XLogP of 0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopiperidin-4-one;hydrochloride is sourced from PubChem (CID 118999019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).