About 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide
4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide (PubChem CID 11899977) has the molecular formula C18H20N2O2S
and a molecular weight of 328.44 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide |
| PubChem CID | 11899977 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide |
| SMILES | C/C(=N/NS(=O)(=O)c1ccc(C)cc1)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2S/c1-13-8-10-16(11-9-13)23(21,22)20-19-14(2)17-12-18(17)15-6-4-3-5-7-15/h3-11,17-18,20H,12H2,1-2H3/b19-14-/t17-,18-/m1/s1 |
| InChIKey | CYTXZSSGRJWZNE-UEJLOKKHSA-N |
| XLogP | 3.45 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide?
The IUPAC name of 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide (CID 11899977) is 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide.
What is the SMILES notation for 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide?
The canonical SMILES for 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide is C/C(=N/NS(=O)(=O)c1ccc(C)cc1)[C@H]1C[C@@H]1c1ccccc1.
What is the InChIKey of 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide?
The InChIKey is CYTXZSSGRJWZNE-UEJLOKKHSA-N. The full InChI is InChI=1S/C18H20N2O2S/c1-13-8-10-16(11-9-13)23(21,22)20-19-14(2)17-12-18(17)15-6-4-3-5-7-15/h3-11,17-18,20H,12H2,1-2H3/b19-14-/t17-,18-/m1/s1.
What are the key properties of 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide?
4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide has a molecular weight of 328.44 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[(Z)-1-[(1S,2S)-2-phenylcyclopropyl]ethylideneamino]benzenesulfonamide is sourced from PubChem (CID 11899977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).