C6H6F2N4O2 — CID 119002066
6-(difluoromethyl)-5-nitropyridine-2,3-diamine (PubChem CID 119002066) has the molecular formula C6H6F2N4O2 and a molecular weight of 204.14 g/mol. Its IUPAC name is 6-(difluoromethyl)-5-nitropyridine-2,3-diamine.
| Compound Name | 6-(difluoromethyl)-5-nitropyridine-2,3-diamine |
|---|---|
| PubChem CID | 119002066 |
| Molecular Formula | C6H6F2N4O2 |
| Molecular Weight | 204.14 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 6-(difluoromethyl)-5-nitropyridine-2,3-diamine |
| SMILES | Nc1cc([N+](=O)[O-])c(C(F)F)nc1N |
| InChI | InChI=1S/C6H6F2N4O2/c7-5(8)4-3(12(13)14)1-2(9)6(10)11-4/h1,5H,9H2,(H2,10,11) |
| InChIKey | WTCZXVNSKSLTQV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|