C13H21ClO2 — CID 11900414
(2R,4R)-4-(chloromethyl)-2-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolane (PubChem CID 11900414) has the molecular formula C13H21ClO2 and a molecular weight of 244.76 g/mol. Its IUPAC name is (2R,4R)-4-(chloromethyl)-2-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolane.
| Compound Name | (2R,4R)-4-(chloromethyl)-2-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11900414 |
| Molecular Formula | C13H21ClO2 |
| Molecular Weight | 244.76 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2R,4R)-4-(chloromethyl)-2-[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]-1,3-dioxolane |
| SMILES | CC1=C[C@H](C)[C@H]([C@@H]2OC[C@H](CCl)O2)[C@H](C)C1 |
| InChI | InChI=1S/C13H21ClO2/c1-8-4-9(2)12(10(3)5-8)13-15-7-11(6-14)16-13/h4,9-13H,5-7H2,1-3H3/t9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | TXMXLUMZDKOOCT-FPYNETTCSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.76 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|