About methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate
methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate (PubChem CID 1190050) has the molecular formula C22H18O9
and a molecular weight of 426.38 g/mol. Its IUPAC name is methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate.
Molecular Properties
| Compound Name | methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate |
| PubChem CID | 1190050 |
| Molecular Formula | C22H18O9 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2c(C)oc3cc(OC(C)=O)cc(OC(C)=O)c3c2=O)cc1 |
| InChI | InChI=1S/C22H18O9/c1-11-21(31-15-7-5-14(6-8-15)22(26)27-4)20(25)19-17(28-11)9-16(29-12(2)23)10-18(19)30-13(3)24/h5-10H,1-4H3 |
| InChIKey | MXDYYFHCHZXXMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate?
The IUPAC name of methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate (CID 1190050) is methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate.
What is the SMILES notation for methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate?
The canonical SMILES for methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate is COC(=O)c1ccc(Oc2c(C)oc3cc(OC(C)=O)cc(OC(C)=O)c3c2=O)cc1.
What is the InChIKey of methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate?
The InChIKey is MXDYYFHCHZXXMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18O9/c1-11-21(31-15-7-5-14(6-8-15)22(26)27-4)20(25)19-17(28-11)9-16(29-12(2)23)10-18(19)30-13(3)24/h5-10H,1-4H3.
What are the key properties of methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate?
methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate has a molecular weight of 426.38 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5,7-diacetyloxy-2-methyl-4-oxochromen-3-yl)oxybenzoate is sourced from PubChem (CID 1190050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).