C13H17N3O2 — CID 11900547
(3aR,7aS)-2-oxido-1-phenylmethoxy-3a,4,5,6,7,7a-hexahydrobenzotriazol-2-ium (PubChem CID 11900547) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (3aR,7aS)-2-oxido-1-phenylmethoxy-3a,4,5,6,7,7a-hexahydrobenzotriazol-2-ium.
| Compound Name | (3aR,7aS)-2-oxido-1-phenylmethoxy-3a,4,5,6,7,7a-hexahydrobenzotriazol-2-ium |
|---|---|
| PubChem CID | 11900547 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (3aR,7aS)-2-oxido-1-phenylmethoxy-3a,4,5,6,7,7a-hexahydrobenzotriazol-2-ium |
| SMILES | [O-][N+]1=N[C@@H]2CCCC[C@@H]2N1OCc1ccccc1 |
| InChI | InChI=1S/C13H17N3O2/c17-16-14-12-8-4-5-9-13(12)15(16)18-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2/t12-,13+/m1/s1 |
| InChIKey | NCRUWSXQSHNFIR-OLZOCXBDSA-N |
| XLogP | 2.62 |
| TPSA | 50.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|