C11H8F3N3O2S — CID 119005534
benzyl N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 119005534) has the molecular formula C11H8F3N3O2S and a molecular weight of 303.27 g/mol. Its IUPAC name is benzyl N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | benzyl N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 119005534 |
| Molecular Formula | C11H8F3N3O2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | benzyl N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | O=C(Nc1nnc(C(F)(F)F)s1)OCc1ccccc1 |
| InChI | InChI=1S/C11H8F3N3O2S/c12-11(13,14)8-16-17-9(20-8)15-10(18)19-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,15,17,18) |
| InChIKey | OVFULXHHIMLUDM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |