C19H17Cl2NO2 — CID 11900572
(1R,2R,6R,7S)-10-butan-2-ylidene-4-(3,5-dichlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 11900572) has the molecular formula C19H17Cl2NO2 and a molecular weight of 362.26 g/mol. Its IUPAC name is (1R,2R,6R,7S)-10-butan-2-ylidene-4-(3,5-dichlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7S)-10-butan-2-ylidene-4-(3,5-dichlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 11900572 |
| Molecular Formula | C19H17Cl2NO2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (1R,2R,6R,7S)-10-butan-2-ylidene-4-(3,5-dichlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC/C(C)=C1\[C@H]2C=C[C@@H]1[C@H]1C(=O)N(c3cc(Cl)cc(Cl)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C19H17Cl2NO2/c1-3-9(2)15-13-4-5-14(15)17-16(13)18(23)22(19(17)24)12-7-10(20)6-11(21)8-12/h4-8,13-14,16-17H,3H2,1-2H3/b15-9-/t13-,14+,16+,17+/m0/s1 |
| InChIKey | DXVUAPWZLBEGEU-WUUDVOMRSA-N |
| XLogP | 4.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|