C8H8F2N2O2 — CID 119006118
2-amino-3-(difluoromethyl)-6-methylpyridine-4-carboxylic acid (PubChem CID 119006118) has the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. Its IUPAC name is 2-amino-3-(difluoromethyl)-6-methylpyridine-4-carboxylic acid.
| Compound Name | 2-amino-3-(difluoromethyl)-6-methylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 119006118 |
| Molecular Formula | C8H8F2N2O2 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-amino-3-(difluoromethyl)-6-methylpyridine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C(F)F)c(N)n1 |
| InChI | InChI=1S/C8H8F2N2O2/c1-3-2-4(8(13)14)5(6(9)10)7(11)12-3/h2,6H,1H3,(H2,11,12)(H,13,14) |
| InChIKey | OLBYETHUHGDBSY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |