C7H6F3N3O2 — CID 119006501
2-amino-5-(trifluoromethoxy)pyridine-4-carboxamide (PubChem CID 119006501) has the molecular formula C7H6F3N3O2 and a molecular weight of 221.14 g/mol. Its IUPAC name is 2-amino-5-(trifluoromethoxy)pyridine-4-carboxamide.
| Compound Name | 2-amino-5-(trifluoromethoxy)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 119006501 |
| Molecular Formula | C7H6F3N3O2 |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-amino-5-(trifluoromethoxy)pyridine-4-carboxamide |
| SMILES | NC(=O)c1cc(N)ncc1OC(F)(F)F |
| InChI | InChI=1S/C7H6F3N3O2/c8-7(9,10)15-4-2-13-5(11)1-3(4)6(12)14/h1-2H,(H2,11,13)(H2,12,14) |
| InChIKey | HBMBLZYSMWOBJR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |