About 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid
2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid (PubChem CID 119006668) has the molecular formula C13H9Cl3N2O2
and a molecular weight of 331.59 g/mol. Its IUPAC name is 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid |
| PubChem CID | 119006668 |
| Molecular Formula | C13H9Cl3N2O2 |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid |
| SMILES | Nc1ncc(CC(=O)O)cc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl3N2O2/c14-9-3-7(4-10(15)12(9)16)8-1-6(2-11(19)20)5-18-13(8)17/h1,3-5H,2H2,(H2,17,18)(H,19,20) |
| InChIKey | DBALBSFSPZRSBS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid?
The IUPAC name of 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid (CID 119006668) is 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid.
What is the SMILES notation for 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid?
The canonical SMILES for 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid is Nc1ncc(CC(=O)O)cc1-c1cc(Cl)c(Cl)c(Cl)c1.
What is the InChIKey of 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid?
The InChIKey is DBALBSFSPZRSBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl3N2O2/c14-9-3-7(4-10(15)12(9)16)8-1-6(2-11(19)20)5-18-13(8)17/h1,3-5H,2H2,(H2,17,18)(H,19,20).
What are the key properties of 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid?
2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid has a molecular weight of 331.59 g/mol, XLogP of 3.92, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-amino-5-(3,4,5-trichlorophenyl)-3-pyridinyl]acetic acid is sourced from PubChem (CID 119006668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).