C8H5F5N2O2 — CID 119007498
2-amino-6-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carbaldehyde (PubChem CID 119007498) has the molecular formula C8H5F5N2O2 and a molecular weight of 256.13 g/mol. Its IUPAC name is 2-amino-6-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carbaldehyde.
| Compound Name | 2-amino-6-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 119007498 |
| Molecular Formula | C8H5F5N2O2 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-amino-6-(difluoromethyl)-5-(trifluoromethoxy)pyridine-3-carbaldehyde |
| SMILES | Nc1nc(C(F)F)c(OC(F)(F)F)cc1C=O |
| InChI | InChI=1S/C8H5F5N2O2/c9-6(10)5-4(17-8(11,12)13)1-3(2-16)7(14)15-5/h1-2,6H,(H2,14,15) |
| InChIKey | GYLBLYPKHDLDQO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|