About 2,3,4-tribromobenzamide
2,3,4-tribromobenzamide (PubChem CID 119007810) has the molecular formula C7H4Br3NO
and a molecular weight of 357.83 g/mol. Its IUPAC name is 2,3,4-tribromobenzamide.
Molecular Properties
| Compound Name | 2,3,4-tribromobenzamide |
| PubChem CID | 119007810 |
| Molecular Formula | C7H4Br3NO |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 354.78 |
| IUPAC Name | 2,3,4-tribromobenzamide |
| SMILES | NC(=O)c1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C7H4Br3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
| InChIKey | QJTATFQHXUPTAP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4-tribromobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-tribromobenzamide?
The IUPAC name of 2,3,4-tribromobenzamide (CID 119007810) is 2,3,4-tribromobenzamide.
What is the SMILES notation for 2,3,4-tribromobenzamide?
The canonical SMILES for 2,3,4-tribromobenzamide is NC(=O)c1ccc(Br)c(Br)c1Br.
What is the InChIKey of 2,3,4-tribromobenzamide?
The InChIKey is QJTATFQHXUPTAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12).
What are the key properties of 2,3,4-tribromobenzamide?
2,3,4-tribromobenzamide has a molecular weight of 357.83 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-tribromobenzamide is sourced from PubChem (CID 119007810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).