About 1,3-benzoxazole-2,4-dicarbaldehyde
1,3-benzoxazole-2,4-dicarbaldehyde (PubChem CID 119010642) has the molecular formula C9H5NO3
and a molecular weight of 175.14 g/mol. Its IUPAC name is 1,3-benzoxazole-2,4-dicarbaldehyde.
Molecular Properties
| Compound Name | 1,3-benzoxazole-2,4-dicarbaldehyde |
| PubChem CID | 119010642 |
| Molecular Formula | C9H5NO3 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 1,3-benzoxazole-2,4-dicarbaldehyde |
| SMILES | O=Cc1nc2c(C=O)cccc2o1 |
| InChI | InChI=1S/C9H5NO3/c11-4-6-2-1-3-7-9(6)10-8(5-12)13-7/h1-5H |
| InChIKey | HANKBEWEQLPLFX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzoxazole-2,4-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzoxazole-2,4-dicarbaldehyde?
The IUPAC name of 1,3-benzoxazole-2,4-dicarbaldehyde (CID 119010642) is 1,3-benzoxazole-2,4-dicarbaldehyde.
What is the SMILES notation for 1,3-benzoxazole-2,4-dicarbaldehyde?
The canonical SMILES for 1,3-benzoxazole-2,4-dicarbaldehyde is O=Cc1nc2c(C=O)cccc2o1.
What is the InChIKey of 1,3-benzoxazole-2,4-dicarbaldehyde?
The InChIKey is HANKBEWEQLPLFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO3/c11-4-6-2-1-3-7-9(6)10-8(5-12)13-7/h1-5H.
What are the key properties of 1,3-benzoxazole-2,4-dicarbaldehyde?
1,3-benzoxazole-2,4-dicarbaldehyde has a molecular weight of 175.14 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzoxazole-2,4-dicarbaldehyde is sourced from PubChem (CID 119010642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).