C12H19NO3 — CID 119011339
(3R,7aR)-3-tert-butyl-7a-ethenyl-5-hydroxy-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 119011339) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (3R,7aR)-3-tert-butyl-7a-ethenyl-5-hydroxy-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (3R,7aR)-3-tert-butyl-7a-ethenyl-5-hydroxy-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 119011339 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (3R,7aR)-3-tert-butyl-7a-ethenyl-5-hydroxy-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | C=C[C@@]12CCC(O)N1[C@@H](C(C)(C)C)OC2=O |
| InChI | InChI=1S/C12H19NO3/c1-5-12-7-6-8(14)13(12)9(11(2,3)4)16-10(12)15/h5,8-9,14H,1,6-7H2,2-4H3/t8?,9-,12+/m1/s1 |
| InChIKey | OSMNXSOTZQLTFX-IBMSWFNTSA-N |
| XLogP | 1.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|