About 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile
4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile (PubChem CID 119011408) has the molecular formula C10H3F8N
and a molecular weight of 289.13 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile |
| PubChem CID | 119011408 |
| Molecular Formula | C10H3F8N |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)c(C(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H3F8N/c11-8(12)5-2-6(9(13,14)15)4(3-19)1-7(5)10(16,17)18/h1-2,8H |
| InChIKey | MARNTUDNQQCUAW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile?
The IUPAC name of 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile (CID 119011408) is 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile.
What is the SMILES notation for 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile?
The canonical SMILES for 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile is N#Cc1cc(C(F)(F)F)c(C(F)F)cc1C(F)(F)F.
What is the InChIKey of 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile?
The InChIKey is MARNTUDNQQCUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3F8N/c11-8(12)5-2-6(9(13,14)15)4(3-19)1-7(5)10(16,17)18/h1-2,8H.
What are the key properties of 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile?
4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile has a molecular weight of 289.13 g/mol, XLogP of 4.53, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-2,5-bis(trifluoromethyl)benzonitrile is sourced from PubChem (CID 119011408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).