C9H5ClF5NO2 — CID 119012110
2-[6-chloro-4-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]acetic acid (PubChem CID 119012110) has the molecular formula C9H5ClF5NO2 and a molecular weight of 289.59 g/mol. Its IUPAC name is 2-[6-chloro-4-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[6-chloro-4-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 119012110 |
| Molecular Formula | C9H5ClF5NO2 |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-[6-chloro-4-(difluoromethyl)-5-(trifluoromethyl)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(F)F)c(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C9H5ClF5NO2/c10-7-6(9(13,14)15)4(8(11)12)1-3(16-7)2-5(17)18/h1,8H,2H2,(H,17,18) |
| InChIKey | NSSAUGZNUJCYNJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|