C29H32NO+ — CID 11901360
[(3R,4R,4aR,8aS)-1-benzyl-4-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-3-yl]-phenylmethanone (PubChem CID 11901360) has the molecular formula C29H32NO+ and a molecular weight of 410.58 g/mol. Its IUPAC name is [(3R,4R,4aR,8aS)-1-benzyl-4-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-3-yl]-phenylmethanone.
| Compound Name | [(3R,4R,4aR,8aS)-1-benzyl-4-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11901360 |
| Molecular Formula | C29H32NO+ |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [(3R,4R,4aR,8aS)-1-benzyl-4-phenyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1C[NH+](Cc2ccccc2)[C@H]2CCCC[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H31NO/c31-29(24-16-8-3-9-17-24)26-21-30(20-22-12-4-1-5-13-22)27-19-11-10-18-25(27)28(26)23-14-6-2-7-15-23/h1-9,12-17,25-28H,10-11,18-21H2/p+1/t25-,26-,27-,28+/m0/s1 |
| InChIKey | YYSUQPONLFVCFZ-LAJGZZDBSA-O |
| XLogP | 4.93 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |