C29H31NO — CID 11901363
[(3S,4R,4aR,8aS)-1-benzyl-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-3-yl]-phenylmethanone (PubChem CID 11901363) has the molecular formula C29H31NO and a molecular weight of 409.57 g/mol. Its IUPAC name is [(3S,4R,4aR,8aS)-1-benzyl-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-3-yl]-phenylmethanone.
| Compound Name | [(3S,4R,4aR,8aS)-1-benzyl-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11901363 |
| Molecular Formula | C29H31NO |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | [(3S,4R,4aR,8aS)-1-benzyl-4-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1CN(Cc2ccccc2)[C@H]2CCCC[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H31NO/c31-29(24-16-8-3-9-17-24)26-21-30(20-22-12-4-1-5-13-22)27-19-11-10-18-25(27)28(26)23-14-6-2-7-15-23/h1-9,12-17,25-28H,10-11,18-21H2/t25-,26+,27-,28+/m0/s1 |
| InChIKey | YYSUQPONLFVCFZ-ZVBOOHQUSA-N |
| XLogP | 6.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |