About 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile
6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile (PubChem CID 119013699) has the molecular formula C7H2F4N2
and a molecular weight of 190.10 g/mol. Its IUPAC name is 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile.
Analyze 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile?
The IUPAC name of 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile (CID 119013699) is 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile.
What is the SMILES notation for 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile?
The canonical SMILES for 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile is N#Cc1nc(C(F)F)c(F)cc1F.
What is the InChIKey of 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile?
The InChIKey is VYIVDQVIGPOTJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2F4N2/c8-3-1-4(9)6(7(10)11)13-5(3)2-12/h1,7H.
What are the key properties of 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile?
6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile has a molecular weight of 190.10 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-3,5-difluoropyridine-2-carbonitrile is sourced from PubChem (CID 119013699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).