C20H29NO6 — CID 11901457
[2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate (PubChem CID 11901457) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate.
| Compound Name | [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 11901457 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [2-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2,4,5-trimethoxybenzoate |
| SMILES | COc1cc(OC)c(C(=O)OCC(=O)N[C@H]2CCC[C@@H](C)[C@H]2C)cc1OC |
| InChI | InChI=1S/C20H29NO6/c1-12-7-6-8-15(13(12)2)21-19(22)11-27-20(23)14-9-17(25-4)18(26-5)10-16(14)24-3/h9-10,12-13,15H,6-8,11H2,1-5H3,(H,21,22)/t12-,13-,15+/m1/s1 |
| InChIKey | WKURPAJXQMWCFF-NFAWXSAZSA-N |
| XLogP | 2.81 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |