About 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene
1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene (PubChem CID 119015553) has the molecular formula C7H2Br2F4
and a molecular weight of 321.89 g/mol. Its IUPAC name is 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene.
Molecular Properties
| Compound Name | 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene |
| PubChem CID | 119015553 |
| Molecular Formula | C7H2Br2F4 |
| Molecular Weight | 321.89 g/mol |
| Exact Mass | 319.85 |
| IUPAC Name | 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene |
| SMILES | Fc1cc(Br)c(F)c(Br)c1C(F)F |
| InChI | InChI=1S/C7H2Br2F4/c8-2-1-3(10)4(7(12)13)5(9)6(2)11/h1,7H |
| InChIKey | TUCBGWIGKIRQEI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.89 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene?
The IUPAC name of 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene (CID 119015553) is 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene.
What is the SMILES notation for 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene?
The canonical SMILES for 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene is Fc1cc(Br)c(F)c(Br)c1C(F)F.
What is the InChIKey of 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene?
The InChIKey is TUCBGWIGKIRQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Br2F4/c8-2-1-3(10)4(7(12)13)5(9)6(2)11/h1,7H.
What are the key properties of 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene?
1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene has a molecular weight of 321.89 g/mol, XLogP of 4.43, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-4-(difluoromethyl)-2,5-difluorobenzene is sourced from PubChem (CID 119015553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).