C23H20N2O2S — CID 11901568
(5R,10bR)-2-(4-prop-2-enoxyphenyl)-5-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 11901568) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is (5R,10bR)-2-(4-prop-2-enoxyphenyl)-5-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5R,10bR)-2-(4-prop-2-enoxyphenyl)-5-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 11901568 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (5R,10bR)-2-(4-prop-2-enoxyphenyl)-5-thiophen-2-yl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | C=CCOc1ccc(C2=NN3[C@H](C2)c2ccccc2O[C@@H]3c2cccs2)cc1 |
| InChI | InChI=1S/C23H20N2O2S/c1-2-13-26-17-11-9-16(10-12-17)19-15-20-18-6-3-4-7-21(18)27-23(25(20)24-19)22-8-5-14-28-22/h2-12,14,20,23H,1,13,15H2/t20-,23-/m1/s1 |
| InChIKey | VKZRSHLBGQBFCS-NFBKMPQASA-N |
| XLogP | 5.56 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|