About 7-(chloromethyl)-1,3-benzoxazol-2-amine
7-(chloromethyl)-1,3-benzoxazol-2-amine (PubChem CID 119016516) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is 7-(chloromethyl)-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 7-(chloromethyl)-1,3-benzoxazol-2-amine |
| PubChem CID | 119016516 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 7-(chloromethyl)-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cccc(CCl)c2o1 |
| InChI | InChI=1S/C8H7ClN2O/c9-4-5-2-1-3-6-7(5)12-8(10)11-6/h1-3H,4H2,(H2,10,11) |
| InChIKey | MXMUIYASBNBCNO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(chloromethyl)-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(chloromethyl)-1,3-benzoxazol-2-amine?
The IUPAC name of 7-(chloromethyl)-1,3-benzoxazol-2-amine (CID 119016516) is 7-(chloromethyl)-1,3-benzoxazol-2-amine.
What is the SMILES notation for 7-(chloromethyl)-1,3-benzoxazol-2-amine?
The canonical SMILES for 7-(chloromethyl)-1,3-benzoxazol-2-amine is Nc1nc2cccc(CCl)c2o1.
What is the InChIKey of 7-(chloromethyl)-1,3-benzoxazol-2-amine?
The InChIKey is MXMUIYASBNBCNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O/c9-4-5-2-1-3-6-7(5)12-8(10)11-6/h1-3H,4H2,(H2,10,11).
What are the key properties of 7-(chloromethyl)-1,3-benzoxazol-2-amine?
7-(chloromethyl)-1,3-benzoxazol-2-amine has a molecular weight of 182.61 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(chloromethyl)-1,3-benzoxazol-2-amine is sourced from PubChem (CID 119016516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).