C7H8F2N4O2 — CID 119016926
5-(aminomethyl)-4-(difluoromethyl)-3-nitropyridin-2-amine (PubChem CID 119016926) has the molecular formula C7H8F2N4O2 and a molecular weight of 218.16 g/mol. Its IUPAC name is 5-(aminomethyl)-4-(difluoromethyl)-3-nitropyridin-2-amine.
| Compound Name | 5-(aminomethyl)-4-(difluoromethyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 119016926 |
| Molecular Formula | C7H8F2N4O2 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5-(aminomethyl)-4-(difluoromethyl)-3-nitropyridin-2-amine |
| SMILES | NCc1cnc(N)c([N+](=O)[O-])c1C(F)F |
| InChI | InChI=1S/C7H8F2N4O2/c8-6(9)4-3(1-10)2-12-7(11)5(4)13(14)15/h2,6H,1,10H2,(H2,11,12) |
| InChIKey | IUDRPVBJGQFOKY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|