About 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride
2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride (PubChem CID 119017770) has the molecular formula C21H28ClNO2
and a molecular weight of 361.91 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride |
| PubChem CID | 119017770 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride |
| SMILES | CCN(CC)CCOC(Cc1ccccc1)C(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO2.ClH/c1-3-22(4-2)15-16-24-20(17-18-11-7-5-8-12-18)21(23)19-13-9-6-10-14-19;/h5-14,20H,3-4,15-17H2,1-2H3;1H |
| InChIKey | WFCPIBKTDAAALD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride?
The IUPAC name of 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride (CID 119017770) is 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride.
What is the SMILES notation for 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride?
The canonical SMILES for 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride is CCN(CC)CCOC(Cc1ccccc1)C(=O)c1ccccc1.Cl.
What is the InChIKey of 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride?
The InChIKey is WFCPIBKTDAAALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO2.ClH/c1-3-22(4-2)15-16-24-20(17-18-11-7-5-8-12-18)21(23)19-13-9-6-10-14-19;/h5-14,20H,3-4,15-17H2,1-2H3;1H.
What are the key properties of 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride?
2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride has a molecular weight of 361.91 g/mol, XLogP of 4.26, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)ethoxy]-1,3-diphenylpropan-1-one;hydrochloride is sourced from PubChem (CID 119017770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).