C17H19FN2O5 — CID 11901997
methyl (1S,3S,3aR,6aR)-5-ethyl-1-(4-fluorophenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 11901997) has the molecular formula C17H19FN2O5 and a molecular weight of 350.35 g/mol. Its IUPAC name is methyl (1S,3S,3aR,6aR)-5-ethyl-1-(4-fluorophenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3S,3aR,6aR)-5-ethyl-1-(4-fluorophenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11901997 |
| Molecular Formula | C17H19FN2O5 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | methyl (1S,3S,3aR,6aR)-5-ethyl-1-(4-fluorophenyl)-3-(hydroxymethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCN1C(=O)[C@H]2[C@@H](c3ccc(F)cc3)N[C@@](CO)(C(=O)OC)[C@@H]2C1=O |
| InChI | InChI=1S/C17H19FN2O5/c1-3-20-14(22)11-12(15(20)23)17(8-21,16(24)25-2)19-13(11)9-4-6-10(18)7-5-9/h4-7,11-13,19,21H,3,8H2,1-2H3/t11-,12+,13-,17-/m1/s1 |
| InChIKey | LQOIHZUXIQTERJ-IPJQOSJUSA-N |
| XLogP | -0.00 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|