About methyl furan-2-carboxylate
methyl furan-2-carboxylate (PubChem CID 11902) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is methyl furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl furan-2-carboxylate |
| PubChem CID | 11902 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | methyl furan-2-carboxylate |
| SMILES | COC(=O)c1ccco1 |
| InChI | InChI=1S/C6H6O3/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| InChIKey | HDJLSECJEQSPKW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl furan-2-carboxylate?
The IUPAC name of methyl furan-2-carboxylate (CID 11902) is methyl furan-2-carboxylate.
What is the SMILES notation for methyl furan-2-carboxylate?
The canonical SMILES for methyl furan-2-carboxylate is COC(=O)c1ccco1.
What is the InChIKey of methyl furan-2-carboxylate?
The InChIKey is HDJLSECJEQSPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3.
What are the key properties of methyl furan-2-carboxylate?
methyl furan-2-carboxylate has a molecular weight of 126.11 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl furan-2-carboxylate is sourced from PubChem (CID 11902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).