C7H4F3N3 — CID 119020377
6-amino-5-(difluoromethyl)-4-fluoropyridine-3-carbonitrile (PubChem CID 119020377) has the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. Its IUPAC name is 6-amino-5-(difluoromethyl)-4-fluoropyridine-3-carbonitrile.
| Compound Name | 6-amino-5-(difluoromethyl)-4-fluoropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 119020377 |
| Molecular Formula | C7H4F3N3 |
| Molecular Weight | 187.12 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 6-amino-5-(difluoromethyl)-4-fluoropyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(N)c(C(F)F)c1F |
| InChI | InChI=1S/C7H4F3N3/c8-5-3(1-11)2-13-7(12)4(5)6(9)10/h2,6H,(H2,12,13) |
| InChIKey | YVZZZCIGDGRFRM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |