C7H5Cl2F2NO — CID 119020401
[5,6-dichloro-4-(difluoromethyl)-3-pyridinyl]methanol (PubChem CID 119020401) has the molecular formula C7H5Cl2F2NO and a molecular weight of 228.02 g/mol. Its IUPAC name is [5,6-dichloro-4-(difluoromethyl)-3-pyridinyl]methanol.
| Compound Name | [5,6-dichloro-4-(difluoromethyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 119020401 |
| Molecular Formula | C7H5Cl2F2NO |
| Molecular Weight | 228.02 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | [5,6-dichloro-4-(difluoromethyl)-3-pyridinyl]methanol |
| SMILES | OCc1cnc(Cl)c(Cl)c1C(F)F |
| InChI | InChI=1S/C7H5Cl2F2NO/c8-5-4(7(10)11)3(2-13)1-12-6(5)9/h1,7,13H,2H2 |
| InChIKey | WFUMRLYIWUYWQK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.02 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|