About 3-hydroxy-2,5-diiodobenzamide
3-hydroxy-2,5-diiodobenzamide (PubChem CID 119020425) has the molecular formula C7H5I2NO2
and a molecular weight of 388.93 g/mol. Its IUPAC name is 3-hydroxy-2,5-diiodobenzamide.
Molecular Properties
| Compound Name | 3-hydroxy-2,5-diiodobenzamide |
| PubChem CID | 119020425 |
| Molecular Formula | C7H5I2NO2 |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.84 |
| IUPAC Name | 3-hydroxy-2,5-diiodobenzamide |
| SMILES | NC(=O)c1cc(I)cc(O)c1I |
| InChI | InChI=1S/C7H5I2NO2/c8-3-1-4(7(10)12)6(9)5(11)2-3/h1-2,11H,(H2,10,12) |
| InChIKey | DKHNSMDJNZJPRJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2,5-diiodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,5-diiodobenzamide?
The IUPAC name of 3-hydroxy-2,5-diiodobenzamide (CID 119020425) is 3-hydroxy-2,5-diiodobenzamide.
What is the SMILES notation for 3-hydroxy-2,5-diiodobenzamide?
The canonical SMILES for 3-hydroxy-2,5-diiodobenzamide is NC(=O)c1cc(I)cc(O)c1I.
What is the InChIKey of 3-hydroxy-2,5-diiodobenzamide?
The InChIKey is DKHNSMDJNZJPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5I2NO2/c8-3-1-4(7(10)12)6(9)5(11)2-3/h1-2,11H,(H2,10,12).
What are the key properties of 3-hydroxy-2,5-diiodobenzamide?
3-hydroxy-2,5-diiodobenzamide has a molecular weight of 388.93 g/mol, XLogP of 1.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,5-diiodobenzamide is sourced from PubChem (CID 119020425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).