C18H15N3O2S2 — CID 1190211
2-[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethyl]isoindole-1,3-dione (PubChem CID 1190211) has the molecular formula C18H15N3O2S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1190211 |
| Molecular Formula | C18H15N3O2S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethyl]isoindole-1,3-dione |
| SMILES | Cc1sc2ncnc(SCCN3C(=O)c4ccccc4C3=O)c2c1C |
| InChI | InChI=1S/C18H15N3O2S2/c1-10-11(2)25-16-14(10)15(19-9-20-16)24-8-7-21-17(22)12-5-3-4-6-13(12)18(21)23/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | IULIJNPJIHNABD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|