About ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate
ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 1190217) has the molecular formula C21H18N2O4S2
and a molecular weight of 426.52 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| PubChem CID | 1190217 |
| Molecular Formula | C21H18N2O4S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C21H18N2O4S2/c1-3-27-21(24)18-16(14-10-8-13(2)9-11-14)12-28-20(18)22-19-15-6-4-5-7-17(15)29(25,26)23-19/h4-12H,3H2,1-2H3,(H,22,23) |
| InChIKey | NMIZJKJUCUHEJT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate?
The IUPAC name of ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate (CID 1190217) is ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
What is the SMILES notation for ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate?
The canonical SMILES for ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate is CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC1=NS(=O)(=O)c2ccccc21.
What is the InChIKey of ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate?
The InChIKey is NMIZJKJUCUHEJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4S2/c1-3-27-21(24)18-16(14-10-8-13(2)9-11-14)12-28-20(18)22-19-15-6-4-5-7-17(15)29(25,26)23-19/h4-12H,3H2,1-2H3,(H,22,23).
What are the key properties of ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate?
ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate has a molecular weight of 426.52 g/mol, XLogP of 4.46, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-4-(4-methylphenyl)thiophene-3-carboxylate is sourced from PubChem (CID 1190217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).