C8H10F2N2O2 — CID 119022056
[2-amino-5-(difluoromethyl)-3-methoxy-4-pyridinyl]methanol (PubChem CID 119022056) has the molecular formula C8H10F2N2O2 and a molecular weight of 204.18 g/mol. Its IUPAC name is [2-amino-5-(difluoromethyl)-3-methoxy-4-pyridinyl]methanol.
| Compound Name | [2-amino-5-(difluoromethyl)-3-methoxy-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 119022056 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | [2-amino-5-(difluoromethyl)-3-methoxy-4-pyridinyl]methanol |
| SMILES | COc1c(N)ncc(C(F)F)c1CO |
| InChI | InChI=1S/C8H10F2N2O2/c1-14-6-5(3-13)4(7(9)10)2-12-8(6)11/h2,7,13H,3H2,1H3,(H2,11,12) |
| InChIKey | KJRQUWNAYMITRJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |