C7H6F2N4O3 — CID 119023564
6-amino-5-(difluoromethyl)-3-nitropyridine-2-carboxamide (PubChem CID 119023564) has the molecular formula C7H6F2N4O3 and a molecular weight of 232.15 g/mol. Its IUPAC name is 6-amino-5-(difluoromethyl)-3-nitropyridine-2-carboxamide.
| Compound Name | 6-amino-5-(difluoromethyl)-3-nitropyridine-2-carboxamide |
|---|---|
| PubChem CID | 119023564 |
| Molecular Formula | C7H6F2N4O3 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 6-amino-5-(difluoromethyl)-3-nitropyridine-2-carboxamide |
| SMILES | NC(=O)c1nc(N)c(C(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6F2N4O3/c8-5(9)2-1-3(13(15)16)4(7(11)14)12-6(2)10/h1,5H,(H2,10,12)(H2,11,14) |
| InChIKey | SFAFGVWKGOWBRD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|