C7H3Cl2F3O2 — CID 119023608
2,3-dichloro-4-(trifluoromethoxy)phenol (PubChem CID 119023608) has the molecular formula C7H3Cl2F3O2 and a molecular weight of 247.00 g/mol. Its IUPAC name is 2,3-dichloro-4-(trifluoromethoxy)phenol.
| Compound Name | 2,3-dichloro-4-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 119023608 |
| Molecular Formula | C7H3Cl2F3O2 |
| Molecular Weight | 247.00 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 2,3-dichloro-4-(trifluoromethoxy)phenol |
| SMILES | Oc1ccc(OC(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl2F3O2/c8-5-3(13)1-2-4(6(5)9)14-7(10,11)12/h1-2,13H |
| InChIKey | PNXSVNXVMKKLAG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.00 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |