C6H4ClF2IN2O2S — CID 119025115
6-chloro-5-(difluoromethyl)-4-iodopyridine-2-sulfonamide (PubChem CID 119025115) has the molecular formula C6H4ClF2IN2O2S and a molecular weight of 368.53 g/mol. Its IUPAC name is 6-chloro-5-(difluoromethyl)-4-iodopyridine-2-sulfonamide.
| Compound Name | 6-chloro-5-(difluoromethyl)-4-iodopyridine-2-sulfonamide |
|---|---|
| PubChem CID | 119025115 |
| Molecular Formula | C6H4ClF2IN2O2S |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 367.87 |
| IUPAC Name | 6-chloro-5-(difluoromethyl)-4-iodopyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(I)c(C(F)F)c(Cl)n1 |
| InChI | InChI=1S/C6H4ClF2IN2O2S/c7-5-4(6(8)9)2(10)1-3(12-5)15(11,13)14/h1,6H,(H2,11,13,14) |
| InChIKey | KERJCLHDCAOKBL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|