About 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide
4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide (PubChem CID 119025614) has the molecular formula C22H18Cl2N2O4
and a molecular weight of 445.30 g/mol. Its IUPAC name is 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide.
Molecular Properties
| Compound Name | 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide |
| PubChem CID | 119025614 |
| Molecular Formula | C22H18Cl2N2O4 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide |
| SMILES | CCC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(-c3ccc(C(N)=O)cc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O4/c1-2-20(28)26-14-9-17(23)21(18(24)10-14)30-15-7-8-19(27)16(11-15)12-3-5-13(6-4-12)22(25)29/h3-11,27H,2H2,1H3,(H2,25,29)(H,26,28) |
| InChIKey | PKFMISFXTVJIPA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide?
The IUPAC name of 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide (CID 119025614) is 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide.
What is the SMILES notation for 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide?
The canonical SMILES for 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide is CCC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(-c3ccc(C(N)=O)cc3)c2)c(Cl)c1.
What is the InChIKey of 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide?
The InChIKey is PKFMISFXTVJIPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2N2O4/c1-2-20(28)26-14-9-17(23)21(18(24)10-14)30-15-7-8-19(27)16(11-15)12-3-5-13(6-4-12)22(25)29/h3-11,27H,2H2,1H3,(H2,25,29)(H,26,28).
What are the key properties of 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide?
4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide has a molecular weight of 445.30 g/mol, XLogP of 5.61, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[2,6-dichloro-4-(propanoylamino)phenoxy]-2-hydroxyphenyl]benzamide is sourced from PubChem (CID 119025614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).