About 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride
3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride (PubChem CID 119030842) has the molecular formula C6H14Cl2N4
and a molecular weight of 213.11 g/mol. Its IUPAC name is 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride |
| PubChem CID | 119030842 |
| Molecular Formula | C6H14Cl2N4 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.Cn1cnnc1CCCN |
| InChI | InChI=1S/C6H12N4.2ClH/c1-10-5-8-9-6(10)3-2-4-7;;/h5H,2-4,7H2,1H3;2*1H |
| InChIKey | OXTHJNIYPKELQQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride?
The IUPAC name of 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride (CID 119030842) is 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride.
What is the SMILES notation for 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride?
The canonical SMILES for 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride is Cl.Cl.Cn1cnnc1CCCN.
What is the InChIKey of 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride?
The InChIKey is OXTHJNIYPKELQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4.2ClH/c1-10-5-8-9-6(10)3-2-4-7;;/h5H,2-4,7H2,1H3;2*1H.
What are the key properties of 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride?
3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride has a molecular weight of 213.11 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-1,2,4-triazol-3-yl)propan-1-amine;dihydrochloride is sourced from PubChem (CID 119030842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).