C5H11F3N2O2S — CID 119030899
2-amino-3,3,3-trifluoro-N,N-dimethylpropane-1-sulfonamide (PubChem CID 119030899) has the molecular formula C5H11F3N2O2S and a molecular weight of 220.22 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 2-amino-3,3,3-trifluoro-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 119030899 |
| Molecular Formula | C5H11F3N2O2S |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-N,N-dimethylpropane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CC(N)C(F)(F)F |
| InChI | InChI=1S/C5H11F3N2O2S/c1-10(2)13(11,12)3-4(9)5(6,7)8/h4H,3,9H2,1-2H3 |
| InChIKey | QGLAOEYYBPVMNJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |