About 2,2-di(cyclobutyl)ethanol
2,2-di(cyclobutyl)ethanol (PubChem CID 119030922) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 2,2-di(cyclobutyl)ethanol.
Molecular Properties
| Compound Name | 2,2-di(cyclobutyl)ethanol |
| PubChem CID | 119030922 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 2,2-di(cyclobutyl)ethanol |
| SMILES | OCC(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C10H18O/c11-7-10(8-3-1-4-8)9-5-2-6-9/h8-11H,1-7H2 |
| InChIKey | USKSWTGZRMFHAE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-di(cyclobutyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-di(cyclobutyl)ethanol?
The IUPAC name of 2,2-di(cyclobutyl)ethanol (CID 119030922) is 2,2-di(cyclobutyl)ethanol.
What is the SMILES notation for 2,2-di(cyclobutyl)ethanol?
The canonical SMILES for 2,2-di(cyclobutyl)ethanol is OCC(C1CCC1)C1CCC1.
What is the InChIKey of 2,2-di(cyclobutyl)ethanol?
The InChIKey is USKSWTGZRMFHAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c11-7-10(8-3-1-4-8)9-5-2-6-9/h8-11H,1-7H2.
What are the key properties of 2,2-di(cyclobutyl)ethanol?
2,2-di(cyclobutyl)ethanol has a molecular weight of 154.25 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-di(cyclobutyl)ethanol is sourced from PubChem (CID 119030922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).