About 2-pyrazol-1-ylphenol;hydrobromide
2-pyrazol-1-ylphenol;hydrobromide (PubChem CID 119030992) has the molecular formula C9H9BrN2O
and a molecular weight of 241.09 g/mol. Its IUPAC name is 2-pyrazol-1-ylphenol;hydrobromide.
Molecular Properties
| Compound Name | 2-pyrazol-1-ylphenol;hydrobromide |
| PubChem CID | 119030992 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 2-pyrazol-1-ylphenol;hydrobromide |
| SMILES | Br.Oc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C9H8N2O.BrH/c12-9-5-2-1-4-8(9)11-7-3-6-10-11;/h1-7,12H;1H |
| InChIKey | VTYFYYCDZDWXKM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrazol-1-ylphenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazol-1-ylphenol;hydrobromide?
The IUPAC name of 2-pyrazol-1-ylphenol;hydrobromide (CID 119030992) is 2-pyrazol-1-ylphenol;hydrobromide.
What is the SMILES notation for 2-pyrazol-1-ylphenol;hydrobromide?
The canonical SMILES for 2-pyrazol-1-ylphenol;hydrobromide is Br.Oc1ccccc1-n1cccn1.
What is the InChIKey of 2-pyrazol-1-ylphenol;hydrobromide?
The InChIKey is VTYFYYCDZDWXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.BrH/c12-9-5-2-1-4-8(9)11-7-3-6-10-11;/h1-7,12H;1H.
What are the key properties of 2-pyrazol-1-ylphenol;hydrobromide?
2-pyrazol-1-ylphenol;hydrobromide has a molecular weight of 241.09 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazol-1-ylphenol;hydrobromide is sourced from PubChem (CID 119030992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).