C11H17F3N2O3 — CID 119030995
1-(2,6-dimethylpiperazin-1-yl)prop-2-en-1-one;2,2,2-trifluoroacetic acid (PubChem CID 119030995) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperazin-1-yl)prop-2-en-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(2,6-dimethylpiperazin-1-yl)prop-2-en-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 119030995 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-(2,6-dimethylpiperazin-1-yl)prop-2-en-1-one;2,2,2-trifluoroacetic acid |
| SMILES | C=CC(=O)N1C(C)CNCC1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H16N2O.C2HF3O2/c1-4-9(12)11-7(2)5-10-6-8(11)3;3-2(4,5)1(6)7/h4,7-8,10H,1,5-6H2,2-3H3;(H,6,7) |
| InChIKey | YCNNPSVIUSMTAO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|