About 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride
4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride (PubChem CID 119031093) has the molecular formula C8H10ClF3N2O2
and a molecular weight of 258.63 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride |
| PubChem CID | 119031093 |
| Molecular Formula | C8H10ClF3N2O2 |
| Molecular Weight | 258.63 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride |
| SMILES | Cl.Cn1ccnc1C(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O2.ClH/c1-13-3-2-12-7(13)5(4-6(14)15)8(9,10)11;/h2-3,5H,4H2,1H3,(H,14,15);1H |
| InChIKey | FWRNZNNRKRWCDE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.63 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride?
The IUPAC name of 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride (CID 119031093) is 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride.
What is the SMILES notation for 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride?
The canonical SMILES for 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride is Cl.Cn1ccnc1C(CC(=O)O)C(F)(F)F.
What is the InChIKey of 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride?
The InChIKey is FWRNZNNRKRWCDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2.ClH/c1-13-3-2-12-7(13)5(4-6(14)15)8(9,10)11;/h2-3,5H,4H2,1H3,(H,14,15);1H.
What are the key properties of 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride?
4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride has a molecular weight of 258.63 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-trifluoro-3-(1-methylimidazol-2-yl)butanoic acid;hydrochloride is sourced from PubChem (CID 119031093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).