About (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride
(3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride (PubChem CID 119031274) has the molecular formula C7H18ClN3O2S
and a molecular weight of 243.76 g/mol. Its IUPAC name is (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride |
| PubChem CID | 119031274 |
| Molecular Formula | C7H18ClN3O2S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride |
| SMILES | CN(C)S(=O)(=O)N1CCC[C@@H](N)C1.Cl |
| InChI | InChI=1S/C7H17N3O2S.ClH/c1-9(2)13(11,12)10-5-3-4-7(8)6-10;/h7H,3-6,8H2,1-2H3;1H/t7-;/m1./s1 |
| InChIKey | CGTIRAPEJOPAQL-OGFXRTJISA-N |
| XLogP | -0.36 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride?
The IUPAC name of (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride (CID 119031274) is (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride.
What is the SMILES notation for (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride?
The canonical SMILES for (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride is CN(C)S(=O)(=O)N1CCC[C@@H](N)C1.Cl.
What is the InChIKey of (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride?
The InChIKey is CGTIRAPEJOPAQL-OGFXRTJISA-N. The full InChI is InChI=1S/C7H17N3O2S.ClH/c1-9(2)13(11,12)10-5-3-4-7(8)6-10;/h7H,3-6,8H2,1-2H3;1H/t7-;/m1./s1.
What are the key properties of (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride?
(3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride has a molecular weight of 243.76 g/mol, XLogP of -0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-N,N-dimethylpiperidine-1-sulfonamide;hydrochloride is sourced from PubChem (CID 119031274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).