About (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride
(2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119031459) has the molecular formula C7H17ClN2OS
and a molecular weight of 212.75 g/mol. Its IUPAC name is (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride |
| PubChem CID | 119031459 |
| Molecular Formula | C7H17ClN2OS |
| Molecular Weight | 212.75 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)N(C)C.Cl |
| InChI | InChI=1S/C7H16N2OS.ClH/c1-9(2)7(10)6(8)4-5-11-3;/h6H,4-5,8H2,1-3H3;1H/t6-;/m0./s1 |
| InChIKey | UOBGELSLQJIZEA-RGMNGODLSA-N |
| XLogP | 0.58 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.75 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride?
The IUPAC name of (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride (CID 119031459) is (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride.
What is the SMILES notation for (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride?
The canonical SMILES for (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride is CSCC[C@H](N)C(=O)N(C)C.Cl.
What is the InChIKey of (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride?
The InChIKey is UOBGELSLQJIZEA-RGMNGODLSA-N. The full InChI is InChI=1S/C7H16N2OS.ClH/c1-9(2)7(10)6(8)4-5-11-3;/h6H,4-5,8H2,1-3H3;1H/t6-;/m0./s1.
What are the key properties of (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride?
(2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride has a molecular weight of 212.75 g/mol, XLogP of 0.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N,N-dimethyl-4-methylsulfanylbutanamide;hydrochloride is sourced from PubChem (CID 119031459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).