C8H2F5N3O3S — CID 119031811
(2,3,4,5,6-pentafluorophenyl) 1H-1,2,4-triazole-5-sulfonate (PubChem CID 119031811) has the molecular formula C8H2F5N3O3S and a molecular weight of 315.18 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1H-1,2,4-triazole-5-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1H-1,2,4-triazole-5-sulfonate |
|---|---|
| PubChem CID | 119031811 |
| Molecular Formula | C8H2F5N3O3S |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1H-1,2,4-triazole-5-sulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1ncn[nH]1 |
| InChI | InChI=1S/C8H2F5N3O3S/c9-2-3(10)5(12)7(6(13)4(2)11)19-20(17,18)8-14-1-15-16-8/h1H,(H,14,15,16) |
| InChIKey | UKBZKACHYMBPMO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|