About 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride
5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride (PubChem CID 119031854) has the molecular formula C10H15ClN2O3
and a molecular weight of 246.69 g/mol. Its IUPAC name is 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride |
| PubChem CID | 119031854 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cc(CN2CCCCC2)on1 |
| InChI | InChI=1S/C10H14N2O3.ClH/c13-10(14)9-6-8(15-11-9)7-12-4-2-1-3-5-12;/h6H,1-5,7H2,(H,13,14);1H |
| InChIKey | LHVNJVPXFMDUBX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride?
The IUPAC name of 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride (CID 119031854) is 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride?
The canonical SMILES for 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride is Cl.O=C(O)c1cc(CN2CCCCC2)on1.
What is the InChIKey of 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride?
The InChIKey is LHVNJVPXFMDUBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3.ClH/c13-10(14)9-6-8(15-11-9)7-12-4-2-1-3-5-12;/h6H,1-5,7H2,(H,13,14);1H.
What are the key properties of 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride?
5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride has a molecular weight of 246.69 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(piperidin-1-ylmethyl)-1,2-oxazole-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 119031854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).