About [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride
[(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride (PubChem CID 119031893) has the molecular formula C10H19ClN2O2
and a molecular weight of 234.73 g/mol. Its IUPAC name is [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride.
Molecular Properties
| Compound Name | [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride |
| PubChem CID | 119031893 |
| Molecular Formula | C10H19ClN2O2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride |
| SMILES | C[C@@H]1CNC[C@H]1C(=O)N1CCOCC1.Cl |
| InChI | InChI=1S/C10H18N2O2.ClH/c1-8-6-11-7-9(8)10(13)12-2-4-14-5-3-12;/h8-9,11H,2-7H2,1H3;1H/t8-,9-;/m1./s1 |
| InChIKey | IKLGZHCANBKWGP-VTLYIQCISA-N |
| XLogP | 0.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride?
The IUPAC name of [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride (CID 119031893) is [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride.
What is the SMILES notation for [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride?
The canonical SMILES for [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride is C[C@@H]1CNC[C@H]1C(=O)N1CCOCC1.Cl.
What is the InChIKey of [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride?
The InChIKey is IKLGZHCANBKWGP-VTLYIQCISA-N. The full InChI is InChI=1S/C10H18N2O2.ClH/c1-8-6-11-7-9(8)10(13)12-2-4-14-5-3-12;/h8-9,11H,2-7H2,1H3;1H/t8-,9-;/m1./s1.
What are the key properties of [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride?
[(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride has a molecular weight of 234.73 g/mol, XLogP of 0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-methylpyrrolidin-3-yl]-morpholin-4-ylmethanone;hydrochloride is sourced from PubChem (CID 119031893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).